C20H18N2O5 — CID 23857776
8-[(2,3-dihydro-1,4-benzodioxin-6-ylamino)methyl]-3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinolin-7-one (PubChem CID 23857776) has the molecular formula C20H18N2O5 and a molecular weight of 366.37 g/mol. Its IUPAC name is 8-[(2,3-dihydro-1,4-benzodioxin-6-ylamino)methyl]-3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinolin-7-one.
| Compound Name | 8-[(2,3-dihydro-1,4-benzodioxin-6-ylamino)methyl]-3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinolin-7-one |
|---|---|
| PubChem CID | 23857776 |
| Molecular Formula | C20H18N2O5 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 8-[(2,3-dihydro-1,4-benzodioxin-6-ylamino)methyl]-3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinolin-7-one |
| SMILES | O=c1[nH]c2cc3c(cc2cc1CNc1ccc2c(c1)OCCO2)OCCO3 |
| InChI | InChI=1S/C20H18N2O5/c23-20-13(11-21-14-1-2-16-18(9-14)26-4-3-24-16)7-12-8-17-19(10-15(12)22-20)27-6-5-25-17/h1-2,7-10,21H,3-6,11H2,(H,22,23) |
| InChIKey | VDIVJYHKDHPEEZ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|