C23H25N3O3 — CID 43817704
7-[[4-(3-methylpiperidin-1-yl)anilino]methyl]-5H-[1,3]dioxolo[4,5-g]quinolin-6-one (PubChem CID 43817704) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is 7-[[4-(3-methylpiperidin-1-yl)anilino]methyl]-5H-[1,3]dioxolo[4,5-g]quinolin-6-one.
| Compound Name | 7-[[4-(3-methylpiperidin-1-yl)anilino]methyl]-5H-[1,3]dioxolo[4,5-g]quinolin-6-one |
|---|---|
| PubChem CID | 43817704 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 7-[[4-(3-methylpiperidin-1-yl)anilino]methyl]-5H-[1,3]dioxolo[4,5-g]quinolin-6-one |
| SMILES | CC1CCCN(c2ccc(NCc3cc4cc5c(cc4[nH]c3=O)OCO5)cc2)C1 |
| InChI | InChI=1S/C23H25N3O3/c1-15-3-2-8-26(13-15)19-6-4-18(5-7-19)24-12-17-9-16-10-21-22(29-14-28-21)11-20(16)25-23(17)27/h4-7,9-11,15,24H,2-3,8,12-14H2,1H3,(H,25,27) |
| InChIKey | RTGJEUCBKKRFRC-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|