C25H31N3O2 — CID 11531553
3-[[4-(3,5-dimethylpiperidin-1-yl)anilino]methyl]-6-ethoxy-1H-quinolin-2-one (PubChem CID 11531553) has the molecular formula C25H31N3O2 and a molecular weight of 405.54 g/mol. Its IUPAC name is 3-[[4-(3,5-dimethylpiperidin-1-yl)anilino]methyl]-6-ethoxy-1H-quinolin-2-one.
| Compound Name | 3-[[4-(3,5-dimethylpiperidin-1-yl)anilino]methyl]-6-ethoxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 11531553 |
| Molecular Formula | C25H31N3O2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | 3-[[4-(3,5-dimethylpiperidin-1-yl)anilino]methyl]-6-ethoxy-1H-quinolin-2-one |
| SMILES | CCOc1ccc2[nH]c(=O)c(CNc3ccc(N4CC(C)CC(C)C4)cc3)cc2c1 |
| InChI | InChI=1S/C25H31N3O2/c1-4-30-23-9-10-24-19(13-23)12-20(25(29)27-24)14-26-21-5-7-22(8-6-21)28-15-17(2)11-18(3)16-28/h5-10,12-13,17-18,26H,4,11,14-16H2,1-3H3,(H,27,29) |
| InChIKey | CXUUXRNIKSHXFZ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|