C25H24N2O2 — CID 46950045
6-ethyl-3-[(4-phenylmethoxyanilino)methyl]-1H-quinolin-2-one (PubChem CID 46950045) has the molecular formula C25H24N2O2 and a molecular weight of 384.48 g/mol. Its IUPAC name is 6-ethyl-3-[(4-phenylmethoxyanilino)methyl]-1H-quinolin-2-one.
| Compound Name | 6-ethyl-3-[(4-phenylmethoxyanilino)methyl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 46950045 |
| Molecular Formula | C25H24N2O2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 6-ethyl-3-[(4-phenylmethoxyanilino)methyl]-1H-quinolin-2-one |
| SMILES | CCc1ccc2[nH]c(=O)c(CNc3ccc(OCc4ccccc4)cc3)cc2c1 |
| InChI | InChI=1S/C25H24N2O2/c1-2-18-8-13-24-20(14-18)15-21(25(28)27-24)16-26-22-9-11-23(12-10-22)29-17-19-6-4-3-5-7-19/h3-15,26H,2,16-17H2,1H3,(H,27,28) |
| InChIKey | FPNQOYKLZHFQCS-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|