C23H28N2O3 — CID 46950053
3-[(2,4-diethoxyanilino)methyl]-6-propyl-1H-quinolin-2-one (PubChem CID 46950053) has the molecular formula C23H28N2O3 and a molecular weight of 380.49 g/mol. Its IUPAC name is 3-[(2,4-diethoxyanilino)methyl]-6-propyl-1H-quinolin-2-one.
| Compound Name | 3-[(2,4-diethoxyanilino)methyl]-6-propyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 46950053 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | 3-[(2,4-diethoxyanilino)methyl]-6-propyl-1H-quinolin-2-one |
| SMILES | CCCc1ccc2[nH]c(=O)c(CNc3ccc(OCC)cc3OCC)cc2c1 |
| InChI | InChI=1S/C23H28N2O3/c1-4-7-16-8-10-20-17(12-16)13-18(23(26)25-20)15-24-21-11-9-19(27-5-2)14-22(21)28-6-3/h8-14,24H,4-7,15H2,1-3H3,(H,25,26) |
| InChIKey | QVMIVCQLVSNVKE-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|