C25H31N3O — CID 46950123
3-[[4-(3,5-dimethylpiperidin-1-yl)anilino]methyl]-6,8-dimethyl-1H-quinolin-2-one (PubChem CID 46950123) has the molecular formula C25H31N3O and a molecular weight of 389.54 g/mol. Its IUPAC name is 3-[[4-(3,5-dimethylpiperidin-1-yl)anilino]methyl]-6,8-dimethyl-1H-quinolin-2-one.
| Compound Name | 3-[[4-(3,5-dimethylpiperidin-1-yl)anilino]methyl]-6,8-dimethyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 46950123 |
| Molecular Formula | C25H31N3O |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.25 |
| IUPAC Name | 3-[[4-(3,5-dimethylpiperidin-1-yl)anilino]methyl]-6,8-dimethyl-1H-quinolin-2-one |
| SMILES | Cc1cc(C)c2[nH]c(=O)c(CNc3ccc(N4CC(C)CC(C)C4)cc3)cc2c1 |
| InChI | InChI=1S/C25H31N3O/c1-16-10-19(4)24-20(11-16)12-21(25(29)27-24)13-26-22-5-7-23(8-6-22)28-14-17(2)9-18(3)15-28/h5-8,10-12,17-18,26H,9,13-15H2,1-4H3,(H,27,29) |
| InChIKey | JAKUALHFHAQFEJ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|