C23H27N3O2 — CID 11625042
3-[[4-(4-hydroxypiperidin-1-yl)anilino]methyl]-7,8-dimethyl-1H-quinolin-2-one (PubChem CID 11625042) has the molecular formula C23H27N3O2 and a molecular weight of 377.49 g/mol. Its IUPAC name is 3-[[4-(4-hydroxypiperidin-1-yl)anilino]methyl]-7,8-dimethyl-1H-quinolin-2-one.
| Compound Name | 3-[[4-(4-hydroxypiperidin-1-yl)anilino]methyl]-7,8-dimethyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 11625042 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 3-[[4-(4-hydroxypiperidin-1-yl)anilino]methyl]-7,8-dimethyl-1H-quinolin-2-one |
| SMILES | Cc1ccc2cc(CNc3ccc(N4CCC(O)CC4)cc3)c(=O)[nH]c2c1C |
| InChI | InChI=1S/C23H27N3O2/c1-15-3-4-17-13-18(23(28)25-22(17)16(15)2)14-24-19-5-7-20(8-6-19)26-11-9-21(27)10-12-26/h3-8,13,21,24,27H,9-12,14H2,1-2H3,(H,25,28) |
| InChIKey | ORHUXVOKDVCDMW-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 68.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|