C24H29N3O — CID 46950102
5,8-dimethyl-3-[[4-(4-methylpiperidin-1-yl)anilino]methyl]-1H-quinolin-2-one (PubChem CID 46950102) has the molecular formula C24H29N3O and a molecular weight of 375.52 g/mol. Its IUPAC name is 5,8-dimethyl-3-[[4-(4-methylpiperidin-1-yl)anilino]methyl]-1H-quinolin-2-one.
| Compound Name | 5,8-dimethyl-3-[[4-(4-methylpiperidin-1-yl)anilino]methyl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 46950102 |
| Molecular Formula | C24H29N3O |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | 5,8-dimethyl-3-[[4-(4-methylpiperidin-1-yl)anilino]methyl]-1H-quinolin-2-one |
| SMILES | Cc1ccc(C)c2[nH]c(=O)c(CNc3ccc(N4CCC(C)CC4)cc3)cc12 |
| InChI | InChI=1S/C24H29N3O/c1-16-10-12-27(13-11-16)21-8-6-20(7-9-21)25-15-19-14-22-17(2)4-5-18(3)23(22)26-24(19)28/h4-9,14,16,25H,10-13,15H2,1-3H3,(H,26,28) |
| InChIKey | KVXPFZCUJVPQJW-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|