C24H32N4O3 — CID 86895908
N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-N'-[4-(4-methylpiperidin-1-yl)phenyl]butanediamide (PubChem CID 86895908) has the molecular formula C24H32N4O3 and a molecular weight of 424.55 g/mol. Its IUPAC name is N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-N'-[4-(4-methylpiperidin-1-yl)phenyl]butanediamide.
| Compound Name | N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-N'-[4-(4-methylpiperidin-1-yl)phenyl]butanediamide |
|---|---|
| PubChem CID | 86895908 |
| Molecular Formula | C24H32N4O3 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-N'-[4-(4-methylpiperidin-1-yl)phenyl]butanediamide |
| SMILES | Cc1cc(C)c(CNC(=O)CCC(=O)Nc2ccc(N3CCC(C)CC3)cc2)c(=O)[nH]1 |
| InChI | InChI=1S/C24H32N4O3/c1-16-10-12-28(13-11-16)20-6-4-19(5-7-20)27-23(30)9-8-22(29)25-15-21-17(2)14-18(3)26-24(21)31/h4-7,14,16H,8-13,15H2,1-3H3,(H,25,29)(H,26,31)(H,27,30) |
| InChIKey | OYNRNECPCQDHLT-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|