C20H22N2O3 — CID 25318836
3-[(2,4-dimethoxyanilino)methyl]-7,8-dimethyl-1H-quinolin-2-one (PubChem CID 25318836) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is 3-[(2,4-dimethoxyanilino)methyl]-7,8-dimethyl-1H-quinolin-2-one.
| Compound Name | 3-[(2,4-dimethoxyanilino)methyl]-7,8-dimethyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 25318836 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 3-[(2,4-dimethoxyanilino)methyl]-7,8-dimethyl-1H-quinolin-2-one |
| SMILES | COc1ccc(NCc2cc3ccc(C)c(C)c3[nH]c2=O)c(OC)c1 |
| InChI | InChI=1S/C20H22N2O3/c1-12-5-6-14-9-15(20(23)22-19(14)13(12)2)11-21-17-8-7-16(24-3)10-18(17)25-4/h5-10,21H,11H2,1-4H3,(H,22,23) |
| InChIKey | GIKXQDXDRDEZBO-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|