C22H22N2O5 — CID 110325095
N-[(7-oxo-3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinolin-8-yl)methyl]-4-phenoxybutanamide (PubChem CID 110325095) has the molecular formula C22H22N2O5 and a molecular weight of 394.43 g/mol. Its IUPAC name is N-[(7-oxo-3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinolin-8-yl)methyl]-4-phenoxybutanamide.
| Compound Name | N-[(7-oxo-3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinolin-8-yl)methyl]-4-phenoxybutanamide |
|---|---|
| PubChem CID | 110325095 |
| Molecular Formula | C22H22N2O5 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | N-[(7-oxo-3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinolin-8-yl)methyl]-4-phenoxybutanamide |
| SMILES | O=C(CCCOc1ccccc1)NCc1cc2cc3c(cc2[nH]c1=O)OCCO3 |
| InChI | InChI=1S/C22H22N2O5/c25-21(7-4-8-27-17-5-2-1-3-6-17)23-14-16-11-15-12-19-20(29-10-9-28-19)13-18(15)24-22(16)26/h1-3,5-6,11-13H,4,7-10,14H2,(H,23,25)(H,24,26) |
| InChIKey | XKNXECLOSXYURK-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 89.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|