C17H17N3O3S — CID 110493454
N-[(4-oxo-3H-thieno[2,3-d]pyrimidin-6-yl)methyl]-4-phenoxybutanamide (PubChem CID 110493454) has the molecular formula C17H17N3O3S and a molecular weight of 343.41 g/mol. Its IUPAC name is N-[(4-oxo-3H-thieno[2,3-d]pyrimidin-6-yl)methyl]-4-phenoxybutanamide.
| Compound Name | N-[(4-oxo-3H-thieno[2,3-d]pyrimidin-6-yl)methyl]-4-phenoxybutanamide |
|---|---|
| PubChem CID | 110493454 |
| Molecular Formula | C17H17N3O3S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | N-[(4-oxo-3H-thieno[2,3-d]pyrimidin-6-yl)methyl]-4-phenoxybutanamide |
| SMILES | O=C(CCCOc1ccccc1)NCc1cc2c(=O)[nH]cnc2s1 |
| InChI | InChI=1S/C17H17N3O3S/c21-15(7-4-8-23-12-5-2-1-3-6-12)18-10-13-9-14-16(22)19-11-20-17(14)24-13/h1-3,5-6,9,11H,4,7-8,10H2,(H,18,21)(H,19,20,22) |
| InChIKey | WTMIKBHYXXPJSM-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|