C18H19N3O4S — CID 110493480
4-(4-methoxyphenoxy)-N-[(4-oxo-3H-thieno[2,3-d]pyrimidin-6-yl)methyl]butanamide (PubChem CID 110493480) has the molecular formula C18H19N3O4S and a molecular weight of 373.43 g/mol. Its IUPAC name is 4-(4-methoxyphenoxy)-N-[(4-oxo-3H-thieno[2,3-d]pyrimidin-6-yl)methyl]butanamide.
| Compound Name | 4-(4-methoxyphenoxy)-N-[(4-oxo-3H-thieno[2,3-d]pyrimidin-6-yl)methyl]butanamide |
|---|---|
| PubChem CID | 110493480 |
| Molecular Formula | C18H19N3O4S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 4-(4-methoxyphenoxy)-N-[(4-oxo-3H-thieno[2,3-d]pyrimidin-6-yl)methyl]butanamide |
| SMILES | COc1ccc(OCCCC(=O)NCc2cc3c(=O)[nH]cnc3s2)cc1 |
| InChI | InChI=1S/C18H19N3O4S/c1-24-12-4-6-13(7-5-12)25-8-2-3-16(22)19-10-14-9-15-17(23)20-11-21-18(15)26-14/h4-7,9,11H,2-3,8,10H2,1H3,(H,19,22)(H,20,21,23) |
| InChIKey | IYPFUEJSNPGRME-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|