C23H24N2O4 — CID 110331396
3-(7-oxo-3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinolin-8-yl)-N-(3-phenylpropyl)propanamide (PubChem CID 110331396) has the molecular formula C23H24N2O4 and a molecular weight of 392.46 g/mol. Its IUPAC name is 3-(7-oxo-3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinolin-8-yl)-N-(3-phenylpropyl)propanamide.
| Compound Name | 3-(7-oxo-3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinolin-8-yl)-N-(3-phenylpropyl)propanamide |
|---|---|
| PubChem CID | 110331396 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 3-(7-oxo-3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinolin-8-yl)-N-(3-phenylpropyl)propanamide |
| SMILES | O=C(CCc1cc2cc3c(cc2[nH]c1=O)OCCO3)NCCCc1ccccc1 |
| InChI | InChI=1S/C23H24N2O4/c26-22(24-10-4-7-16-5-2-1-3-6-16)9-8-17-13-18-14-20-21(29-12-11-28-20)15-19(18)25-23(17)27/h1-3,5-6,13-15H,4,7-12H2,(H,24,26)(H,25,27) |
| InChIKey | XRNHNWLTMJARTD-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|