C16H11ClN4O2 — CID 122637212
3-[(1,2,3-benzoxadiazol-6-ylamino)methyl]-6-chloro-1H-quinolin-2-one (PubChem CID 122637212) has the molecular formula C16H11ClN4O2 and a molecular weight of 326.74 g/mol. Its IUPAC name is 3-[(1,2,3-benzoxadiazol-6-ylamino)methyl]-6-chloro-1H-quinolin-2-one.
| Compound Name | 3-[(1,2,3-benzoxadiazol-6-ylamino)methyl]-6-chloro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 122637212 |
| Molecular Formula | C16H11ClN4O2 |
| Molecular Weight | 326.74 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 3-[(1,2,3-benzoxadiazol-6-ylamino)methyl]-6-chloro-1H-quinolin-2-one |
| SMILES | O=c1[nH]c2ccc(Cl)cc2cc1CNc1ccc2nnoc2c1 |
| InChI | InChI=1S/C16H11ClN4O2/c17-11-1-3-13-9(6-11)5-10(16(22)19-13)8-18-12-2-4-14-15(7-12)23-21-20-14/h1-7,18H,8H2,(H,19,22) |
| InChIKey | CXJSRTCOKXIZPZ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.74 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |