C18H16N2O4 — CID 60593195
3-[3-(1,3-benzodioxol-5-yloxy)propyl]quinazolin-4-one (PubChem CID 60593195) has the molecular formula C18H16N2O4 and a molecular weight of 324.34 g/mol. Its IUPAC name is 3-[3-(1,3-benzodioxol-5-yloxy)propyl]quinazolin-4-one.
| Compound Name | 3-[3-(1,3-benzodioxol-5-yloxy)propyl]quinazolin-4-one |
|---|---|
| PubChem CID | 60593195 |
| Molecular Formula | C18H16N2O4 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 3-[3-(1,3-benzodioxol-5-yloxy)propyl]quinazolin-4-one |
| SMILES | O=c1c2ccccc2ncn1CCCOc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H16N2O4/c21-18-14-4-1-2-5-15(14)19-11-20(18)8-3-9-22-13-6-7-16-17(10-13)24-12-23-16/h1-2,4-7,10-11H,3,8-9,12H2 |
| InChIKey | KPZCSIZNHAUIEF-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|