About 3-(4-oxoquinazolin-3-yl)propyl 3-butoxybenzoate
3-(4-oxoquinazolin-3-yl)propyl 3-butoxybenzoate (PubChem CID 30338475) has the molecular formula C22H24N2O4
and a molecular weight of 380.44 g/mol. Its IUPAC name is 3-(4-oxoquinazolin-3-yl)propyl 3-butoxybenzoate.
Molecular Properties
| Compound Name | 3-(4-oxoquinazolin-3-yl)propyl 3-butoxybenzoate |
| PubChem CID | 30338475 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 3-(4-oxoquinazolin-3-yl)propyl 3-butoxybenzoate |
| SMILES | CCCCOc1cccc(C(=O)OCCCn2cnc3ccccc3c2=O)c1 |
| InChI | InChI=1S/C22H24N2O4/c1-2-3-13-27-18-9-6-8-17(15-18)22(26)28-14-7-12-24-16-23-20-11-5-4-10-19(20)21(24)25/h4-6,8-11,15-16H,2-3,7,12-14H2,1H3 |
| InChIKey | KCNFWOBWIQAWFP-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-oxoquinazolin-3-yl)propyl 3-butoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-oxoquinazolin-3-yl)propyl 3-butoxybenzoate?
The IUPAC name of 3-(4-oxoquinazolin-3-yl)propyl 3-butoxybenzoate (CID 30338475) is 3-(4-oxoquinazolin-3-yl)propyl 3-butoxybenzoate.
What is the SMILES notation for 3-(4-oxoquinazolin-3-yl)propyl 3-butoxybenzoate?
The canonical SMILES for 3-(4-oxoquinazolin-3-yl)propyl 3-butoxybenzoate is CCCCOc1cccc(C(=O)OCCCn2cnc3ccccc3c2=O)c1.
What is the InChIKey of 3-(4-oxoquinazolin-3-yl)propyl 3-butoxybenzoate?
The InChIKey is KCNFWOBWIQAWFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N2O4/c1-2-3-13-27-18-9-6-8-17(15-18)22(26)28-14-7-12-24-16-23-20-11-5-4-10-19(20)21(24)25/h4-6,8-11,15-16H,2-3,7,12-14H2,1H3.
What are the key properties of 3-(4-oxoquinazolin-3-yl)propyl 3-butoxybenzoate?
3-(4-oxoquinazolin-3-yl)propyl 3-butoxybenzoate has a molecular weight of 380.44 g/mol, XLogP of 3.82, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-oxoquinazolin-3-yl)propyl 3-butoxybenzoate is sourced from PubChem (CID 30338475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).