C26H25N3O7S — CID 71197565
2-(4-butoxyphenoxy)ethyl 3-[(4-oxo-1,2,3-benzotriazin-3-yl)sulfonyl]benzoate (PubChem CID 71197565) has the molecular formula C26H25N3O7S and a molecular weight of 523.57 g/mol. Its IUPAC name is 2-(4-butoxyphenoxy)ethyl 3-[(4-oxo-1,2,3-benzotriazin-3-yl)sulfonyl]benzoate.
| Compound Name | 2-(4-butoxyphenoxy)ethyl 3-[(4-oxo-1,2,3-benzotriazin-3-yl)sulfonyl]benzoate |
|---|---|
| PubChem CID | 71197565 |
| Molecular Formula | C26H25N3O7S |
| Molecular Weight | 523.57 g/mol |
| Exact Mass | 523.14 |
| IUPAC Name | 2-(4-butoxyphenoxy)ethyl 3-[(4-oxo-1,2,3-benzotriazin-3-yl)sulfonyl]benzoate |
| SMILES | CCCCOc1ccc(OCCOC(=O)c2cccc(S(=O)(=O)n3nnc4ccccc4c3=O)c2)cc1 |
| InChI | InChI=1S/C26H25N3O7S/c1-2-3-15-34-20-11-13-21(14-12-20)35-16-17-36-26(31)19-7-6-8-22(18-19)37(32,33)29-25(30)23-9-4-5-10-24(23)27-28-29/h4-14,18H,2-3,15-17H2,1H3 |
| InChIKey | YVTJMCBKEYTCGP-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 126.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.57 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|