C18H16N2O5 — CID 7749347
methyl 3-(6,7-dimethoxy-4-oxoquinazolin-3-yl)benzoate (PubChem CID 7749347) has the molecular formula C18H16N2O5 and a molecular weight of 340.34 g/mol. Its IUPAC name is methyl 3-(6,7-dimethoxy-4-oxoquinazolin-3-yl)benzoate.
| Compound Name | methyl 3-(6,7-dimethoxy-4-oxoquinazolin-3-yl)benzoate |
|---|---|
| PubChem CID | 7749347 |
| Molecular Formula | C18H16N2O5 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | methyl 3-(6,7-dimethoxy-4-oxoquinazolin-3-yl)benzoate |
| SMILES | COC(=O)c1cccc(-n2cnc3cc(OC)c(OC)cc3c2=O)c1 |
| InChI | InChI=1S/C18H16N2O5/c1-23-15-8-13-14(9-16(15)24-2)19-10-20(17(13)21)12-6-4-5-11(7-12)18(22)25-3/h4-10H,1-3H3 |
| InChIKey | UVPCMZKXBDRRTH-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |