methyl 3-(4,5-dimethylimidazol-1-yl)benzoate

C13H14N2O2 — CID 71378704

IUPACmethyl 3-(4,5-dimethylimidazol-1-yl)benzoate
SMILESCOC(=O)c1cccc(-n2cnc(C)c2C)c1
InChIInChI=1S/C13H14N2O2/c1-9-10(2)15(8-14-9)12-6-4-5-11(7-12)13(16)17-3/h4-8H,1-3H3
InChIKeyRBQFVUCVQPFAFR-UHFFFAOYSA-N
MW230.27 g/mol
LogP2.28
Rot. Bonds2

About methyl 3-(4,5-dimethylimidazol-1-yl)benzoate

methyl 3-(4,5-dimethylimidazol-1-yl)benzoate (PubChem CID 71378704) has the molecular formula C13H14N2O2 and a molecular weight of 230.27 g/mol. Its IUPAC name is methyl 3-(4,5-dimethylimidazol-1-yl)benzoate.

Molecular Properties

Compound Namemethyl 3-(4,5-dimethylimidazol-1-yl)benzoate
PubChem CID71378704
Molecular FormulaC13H14N2O2
Molecular Weight230.27 g/mol
Exact Mass230.11
IUPAC Namemethyl 3-(4,5-dimethylimidazol-1-yl)benzoate
SMILESCOC(=O)c1cccc(-n2cnc(C)c2C)c1
InChIInChI=1S/C13H14N2O2/c1-9-10(2)15(8-14-9)12-6-4-5-11(7-12)13(16)17-3/h4-8H,1-3H3
InChIKeyRBQFVUCVQPFAFR-UHFFFAOYSA-N
XLogP2.28
TPSA44.12 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500230.27
LogP ≤ 52.28
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 3-(4,5-dimethylimidazol-1-yl)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(4,5-dimethylimidazol-1-yl)benzoate?
The IUPAC name of methyl 3-(4,5-dimethylimidazol-1-yl)benzoate (CID 71378704) is methyl 3-(4,5-dimethylimidazol-1-yl)benzoate.
What is the SMILES notation for methyl 3-(4,5-dimethylimidazol-1-yl)benzoate?
The canonical SMILES for methyl 3-(4,5-dimethylimidazol-1-yl)benzoate is COC(=O)c1cccc(-n2cnc(C)c2C)c1.
What is the InChIKey of methyl 3-(4,5-dimethylimidazol-1-yl)benzoate?
The InChIKey is RBQFVUCVQPFAFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O2/c1-9-10(2)15(8-14-9)12-6-4-5-11(7-12)13(16)17-3/h4-8H,1-3H3.
What are the key properties of methyl 3-(4,5-dimethylimidazol-1-yl)benzoate?
methyl 3-(4,5-dimethylimidazol-1-yl)benzoate has a molecular weight of 230.27 g/mol, XLogP of 2.28, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(4,5-dimethylimidazol-1-yl)benzoate is sourced from PubChem (CID 71378704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).