methyl 3-(3,4,5-trimethylpyrazol-1-yl)benzoate

C14H16N2O2 — CID 50888948

IUPACmethyl 3-(3,4,5-trimethylpyrazol-1-yl)benzoate
SMILESCOC(=O)c1cccc(-n2nc(C)c(C)c2C)c1
InChIInChI=1S/C14H16N2O2/c1-9-10(2)15-16(11(9)3)13-7-5-6-12(8-13)14(17)18-4/h5-8H,1-4H3
InChIKeyCTBWALAGOUVOQC-UHFFFAOYSA-N
MW244.29 g/mol
LogP2.58
Rot. Bonds2

About methyl 3-(3,4,5-trimethylpyrazol-1-yl)benzoate

methyl 3-(3,4,5-trimethylpyrazol-1-yl)benzoate (PubChem CID 50888948) has the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. Its IUPAC name is methyl 3-(3,4,5-trimethylpyrazol-1-yl)benzoate.

Molecular Properties

Compound Namemethyl 3-(3,4,5-trimethylpyrazol-1-yl)benzoate
PubChem CID50888948
Molecular FormulaC14H16N2O2
Molecular Weight244.29 g/mol
Exact Mass244.12
IUPAC Namemethyl 3-(3,4,5-trimethylpyrazol-1-yl)benzoate
SMILESCOC(=O)c1cccc(-n2nc(C)c(C)c2C)c1
InChIInChI=1S/C14H16N2O2/c1-9-10(2)15-16(11(9)3)13-7-5-6-12(8-13)14(17)18-4/h5-8H,1-4H3
InChIKeyCTBWALAGOUVOQC-UHFFFAOYSA-N
XLogP2.58
TPSA44.12 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500244.29
LogP ≤ 52.58
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 3-(3,4,5-trimethylpyrazol-1-yl)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(3,4,5-trimethylpyrazol-1-yl)benzoate?
The IUPAC name of methyl 3-(3,4,5-trimethylpyrazol-1-yl)benzoate (CID 50888948) is methyl 3-(3,4,5-trimethylpyrazol-1-yl)benzoate.
What is the SMILES notation for methyl 3-(3,4,5-trimethylpyrazol-1-yl)benzoate?
The canonical SMILES for methyl 3-(3,4,5-trimethylpyrazol-1-yl)benzoate is COC(=O)c1cccc(-n2nc(C)c(C)c2C)c1.
What is the InChIKey of methyl 3-(3,4,5-trimethylpyrazol-1-yl)benzoate?
The InChIKey is CTBWALAGOUVOQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O2/c1-9-10(2)15-16(11(9)3)13-7-5-6-12(8-13)14(17)18-4/h5-8H,1-4H3.
What are the key properties of methyl 3-(3,4,5-trimethylpyrazol-1-yl)benzoate?
methyl 3-(3,4,5-trimethylpyrazol-1-yl)benzoate has a molecular weight of 244.29 g/mol, XLogP of 2.58, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(3,4,5-trimethylpyrazol-1-yl)benzoate is sourced from PubChem (CID 50888948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).