methyl 3-[4-(aminomethyl)-3,5-dimethylpyrazol-1-yl]benzoate

C14H17N3O2 — CID 84760298

IUPACmethyl 3-[4-(aminomethyl)-3,5-dimethylpyrazol-1-yl]benzoate
SMILESCOC(=O)c1cccc(-n2nc(C)c(CN)c2C)c1
InChIInChI=1S/C14H17N3O2/c1-9-13(8-15)10(2)17(16-9)12-6-4-5-11(7-12)14(18)19-3/h4-7H,8,15H2,1-3H3
InChIKeyGPQNRJDGSGFZHG-UHFFFAOYSA-N
MW259.31 g/mol
LogP1.73
Rot. Bonds3

About methyl 3-[4-(aminomethyl)-3,5-dimethylpyrazol-1-yl]benzoate

methyl 3-[4-(aminomethyl)-3,5-dimethylpyrazol-1-yl]benzoate (PubChem CID 84760298) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is methyl 3-[4-(aminomethyl)-3,5-dimethylpyrazol-1-yl]benzoate.

Molecular Properties

Compound Namemethyl 3-[4-(aminomethyl)-3,5-dimethylpyrazol-1-yl]benzoate
PubChem CID84760298
Molecular FormulaC14H17N3O2
Molecular Weight259.31 g/mol
Exact Mass259.13
IUPAC Namemethyl 3-[4-(aminomethyl)-3,5-dimethylpyrazol-1-yl]benzoate
SMILESCOC(=O)c1cccc(-n2nc(C)c(CN)c2C)c1
InChIInChI=1S/C14H17N3O2/c1-9-13(8-15)10(2)17(16-9)12-6-4-5-11(7-12)14(18)19-3/h4-7H,8,15H2,1-3H3
InChIKeyGPQNRJDGSGFZHG-UHFFFAOYSA-N
XLogP1.73
TPSA70.14 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500259.31
LogP ≤ 51.73
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze methyl 3-[4-(aminomethyl)-3,5-dimethylpyrazol-1-yl]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-[4-(aminomethyl)-3,5-dimethylpyrazol-1-yl]benzoate?
The IUPAC name of methyl 3-[4-(aminomethyl)-3,5-dimethylpyrazol-1-yl]benzoate (CID 84760298) is methyl 3-[4-(aminomethyl)-3,5-dimethylpyrazol-1-yl]benzoate.
What is the SMILES notation for methyl 3-[4-(aminomethyl)-3,5-dimethylpyrazol-1-yl]benzoate?
The canonical SMILES for methyl 3-[4-(aminomethyl)-3,5-dimethylpyrazol-1-yl]benzoate is COC(=O)c1cccc(-n2nc(C)c(CN)c2C)c1.
What is the InChIKey of methyl 3-[4-(aminomethyl)-3,5-dimethylpyrazol-1-yl]benzoate?
The InChIKey is GPQNRJDGSGFZHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3O2/c1-9-13(8-15)10(2)17(16-9)12-6-4-5-11(7-12)14(18)19-3/h4-7H,8,15H2,1-3H3.
What are the key properties of methyl 3-[4-(aminomethyl)-3,5-dimethylpyrazol-1-yl]benzoate?
methyl 3-[4-(aminomethyl)-3,5-dimethylpyrazol-1-yl]benzoate has a molecular weight of 259.31 g/mol, XLogP of 1.73, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[4-(aminomethyl)-3,5-dimethylpyrazol-1-yl]benzoate is sourced from PubChem (CID 84760298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).