C17H23N3O2 — CID 84760296
butyl 3-[4-(aminomethyl)-3,5-dimethylpyrazol-1-yl]benzoate (PubChem CID 84760296) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is butyl 3-[4-(aminomethyl)-3,5-dimethylpyrazol-1-yl]benzoate.
| Compound Name | butyl 3-[4-(aminomethyl)-3,5-dimethylpyrazol-1-yl]benzoate |
|---|---|
| PubChem CID | 84760296 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | butyl 3-[4-(aminomethyl)-3,5-dimethylpyrazol-1-yl]benzoate |
| SMILES | CCCCOC(=O)c1cccc(-n2nc(C)c(CN)c2C)c1 |
| InChI | InChI=1S/C17H23N3O2/c1-4-5-9-22-17(21)14-7-6-8-15(10-14)20-13(3)16(11-18)12(2)19-20/h6-8,10H,4-5,9,11,18H2,1-3H3 |
| InChIKey | SXOCTJSROAJPQH-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|