C15H18N2O — CID 79168257
1-[3-(4-ethyl-3,5-dimethylpyrazol-1-yl)phenyl]ethanone (PubChem CID 79168257) has the molecular formula C15H18N2O and a molecular weight of 242.32 g/mol. Its IUPAC name is 1-[3-(4-ethyl-3,5-dimethylpyrazol-1-yl)phenyl]ethanone.
| Compound Name | 1-[3-(4-ethyl-3,5-dimethylpyrazol-1-yl)phenyl]ethanone |
|---|---|
| PubChem CID | 79168257 |
| Molecular Formula | C15H18N2O |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | 1-[3-(4-ethyl-3,5-dimethylpyrazol-1-yl)phenyl]ethanone |
| SMILES | CCc1c(C)nn(-c2cccc(C(C)=O)c2)c1C |
| InChI | InChI=1S/C15H18N2O/c1-5-15-10(2)16-17(11(15)3)14-8-6-7-13(9-14)12(4)18/h6-9H,5H2,1-4H3 |
| InChIKey | AMPLFLYXEXBSEH-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |