C25H23N3O5 — CID 24512913
4-(4-oxoquinazolin-3-yl)-N-[(2,4,5-trimethoxyphenyl)methyl]benzamide (PubChem CID 24512913) has the molecular formula C25H23N3O5 and a molecular weight of 445.48 g/mol. Its IUPAC name is 4-(4-oxoquinazolin-3-yl)-N-[(2,4,5-trimethoxyphenyl)methyl]benzamide.
| Compound Name | 4-(4-oxoquinazolin-3-yl)-N-[(2,4,5-trimethoxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 24512913 |
| Molecular Formula | C25H23N3O5 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | 4-(4-oxoquinazolin-3-yl)-N-[(2,4,5-trimethoxyphenyl)methyl]benzamide |
| SMILES | COc1cc(OC)c(OC)cc1CNC(=O)c1ccc(-n2cnc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C25H23N3O5/c1-31-21-13-23(33-3)22(32-2)12-17(21)14-26-24(29)16-8-10-18(11-9-16)28-15-27-20-7-5-4-6-19(20)25(28)30/h4-13,15H,14H2,1-3H3,(H,26,29) |
| InChIKey | BGNGYXIXUAOKGG-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |