C21H17BrN4O2 — CID 20916026
N-[(5-bromo-2-methoxyphenyl)methyl]-4-imidazo[4,5-b]pyridin-3-ylbenzamide (PubChem CID 20916026) has the molecular formula C21H17BrN4O2 and a molecular weight of 437.30 g/mol. Its IUPAC name is N-[(5-bromo-2-methoxyphenyl)methyl]-4-imidazo[4,5-b]pyridin-3-ylbenzamide.
| Compound Name | N-[(5-bromo-2-methoxyphenyl)methyl]-4-imidazo[4,5-b]pyridin-3-ylbenzamide |
|---|---|
| PubChem CID | 20916026 |
| Molecular Formula | C21H17BrN4O2 |
| Molecular Weight | 437.30 g/mol |
| Exact Mass | 436.05 |
| IUPAC Name | N-[(5-bromo-2-methoxyphenyl)methyl]-4-imidazo[4,5-b]pyridin-3-ylbenzamide |
| SMILES | COc1ccc(Br)cc1CNC(=O)c1ccc(-n2cnc3cccnc32)cc1 |
| InChI | InChI=1S/C21H17BrN4O2/c1-28-19-9-6-16(22)11-15(19)12-24-21(27)14-4-7-17(8-5-14)26-13-25-18-3-2-10-23-20(18)26/h2-11,13H,12H2,1H3,(H,24,27) |
| InChIKey | BWBCAHFFOJGURU-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.30 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |