C24H22N4O4 — CID 55866271
N-[[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methyl]-4-(benzimidazol-1-yl)benzamide (PubChem CID 55866271) has the molecular formula C24H22N4O4 and a molecular weight of 430.46 g/mol. Its IUPAC name is N-[[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methyl]-4-(benzimidazol-1-yl)benzamide.
| Compound Name | N-[[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methyl]-4-(benzimidazol-1-yl)benzamide |
|---|---|
| PubChem CID | 55866271 |
| Molecular Formula | C24H22N4O4 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | N-[[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methyl]-4-(benzimidazol-1-yl)benzamide |
| SMILES | COc1cc(CNC(=O)c2ccc(-n3cnc4ccccc43)cc2)ccc1OCC(N)=O |
| InChI | InChI=1S/C24H22N4O4/c1-31-22-12-16(6-11-21(22)32-14-23(25)29)13-26-24(30)17-7-9-18(10-8-17)28-15-27-19-4-2-3-5-20(19)28/h2-12,15H,13-14H2,1H3,(H2,25,29)(H,26,30) |
| InChIKey | CFBBUZYFVCOMAB-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |