C22H25N3O5 — CID 27843459
4-oxo-3-propyl-N-[(2,4,5-trimethoxyphenyl)methyl]phthalazine-1-carboxamide (PubChem CID 27843459) has the molecular formula C22H25N3O5 and a molecular weight of 411.46 g/mol. Its IUPAC name is 4-oxo-3-propyl-N-[(2,4,5-trimethoxyphenyl)methyl]phthalazine-1-carboxamide.
| Compound Name | 4-oxo-3-propyl-N-[(2,4,5-trimethoxyphenyl)methyl]phthalazine-1-carboxamide |
|---|---|
| PubChem CID | 27843459 |
| Molecular Formula | C22H25N3O5 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 4-oxo-3-propyl-N-[(2,4,5-trimethoxyphenyl)methyl]phthalazine-1-carboxamide |
| SMILES | CCCn1nc(C(=O)NCc2cc(OC)c(OC)cc2OC)c2ccccc2c1=O |
| InChI | InChI=1S/C22H25N3O5/c1-5-10-25-22(27)16-9-7-6-8-15(16)20(24-25)21(26)23-13-14-11-18(29-3)19(30-4)12-17(14)28-2/h6-9,11-12H,5,10,13H2,1-4H3,(H,23,26) |
| InChIKey | YKWXKYRRZBODOO-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |