C26H25N5O3 — CID 24513988
N'-[4-(diethylamino)benzoyl]-4-(4-oxoquinazolin-3-yl)benzohydrazide (PubChem CID 24513988) has the molecular formula C26H25N5O3 and a molecular weight of 455.52 g/mol. Its IUPAC name is N'-[4-(diethylamino)benzoyl]-4-(4-oxoquinazolin-3-yl)benzohydrazide.
| Compound Name | N'-[4-(diethylamino)benzoyl]-4-(4-oxoquinazolin-3-yl)benzohydrazide |
|---|---|
| PubChem CID | 24513988 |
| Molecular Formula | C26H25N5O3 |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | N'-[4-(diethylamino)benzoyl]-4-(4-oxoquinazolin-3-yl)benzohydrazide |
| SMILES | CCN(CC)c1ccc(C(=O)NNC(=O)c2ccc(-n3cnc4ccccc4c3=O)cc2)cc1 |
| InChI | InChI=1S/C26H25N5O3/c1-3-30(4-2)20-13-9-18(10-14-20)24(32)28-29-25(33)19-11-15-21(16-12-19)31-17-27-23-8-6-5-7-22(23)26(31)34/h5-17H,3-4H2,1-2H3,(H,28,32)(H,29,33) |
| InChIKey | FWIXICYLRZRCPA-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|