C15H14N4O3 — CID 91684222
2-(1,3-benzodioxol-5-yl)-6-ethoxybenzotriazol-5-amine (PubChem CID 91684222) has the molecular formula C15H14N4O3 and a molecular weight of 298.30 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-6-ethoxybenzotriazol-5-amine.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-6-ethoxybenzotriazol-5-amine |
|---|---|
| PubChem CID | 91684222 |
| Molecular Formula | C15H14N4O3 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-6-ethoxybenzotriazol-5-amine |
| SMILES | CCOc1cc2nn(-c3ccc4c(c3)OCO4)nc2cc1N |
| InChI | InChI=1S/C15H14N4O3/c1-2-20-14-7-12-11(6-10(14)16)17-19(18-12)9-3-4-13-15(5-9)22-8-21-13/h3-7H,2,8,16H2,1H3 |
| InChIKey | FVKCGYPWQZWKFX-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|