C21H19NO5 — CID 145147637
17,18-dimethoxy-5,7-dioxa-14-azapentacyclo[12.8.0.02,10.04,8.016,21]docosa-1(22),2,4(8),9,16(21),17,19-heptaen-15-one (PubChem CID 145147637) has the molecular formula C21H19NO5 and a molecular weight of 365.39 g/mol. Its IUPAC name is 17,18-dimethoxy-5,7-dioxa-14-azapentacyclo[12.8.0.02,10.04,8.016,21]docosa-1(22),2,4(8),9,16(21),17,19-heptaen-15-one.
| Compound Name | 17,18-dimethoxy-5,7-dioxa-14-azapentacyclo[12.8.0.02,10.04,8.016,21]docosa-1(22),2,4(8),9,16(21),17,19-heptaen-15-one |
|---|---|
| PubChem CID | 145147637 |
| Molecular Formula | C21H19NO5 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | 17,18-dimethoxy-5,7-dioxa-14-azapentacyclo[12.8.0.02,10.04,8.016,21]docosa-1(22),2,4(8),9,16(21),17,19-heptaen-15-one |
| SMILES | COc1ccc2cc3n(c(=O)c2c1OC)CCCc1cc2c(cc1-3)OCO2 |
| InChI | InChI=1S/C21H19NO5/c1-24-16-6-5-13-8-15-14-10-18-17(26-11-27-18)9-12(14)4-3-7-22(15)21(23)19(13)20(16)25-2/h5-6,8-10H,3-4,7,11H2,1-2H3 |
| InChIKey | GBVJNVUMLUCSSQ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 58.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |