C23H24BrNO5 — CID 145147642
22-bromo-17,18-dimethoxy-5,7-dioxa-14-azapentacyclo[12.8.0.02,10.04,8.016,21]docosa-1(22),2,4(8),9,16(21),17,19-heptaen-15-one;ethane (PubChem CID 145147642) has the molecular formula C23H24BrNO5 and a molecular weight of 474.35 g/mol. Its IUPAC name is 22-bromo-17,18-dimethoxy-5,7-dioxa-14-azapentacyclo[12.8.0.02,10.04,8.016,21]docosa-1(22),2,4(8),9,16(21),17,19-heptaen-15-one;ethane.
| Compound Name | 22-bromo-17,18-dimethoxy-5,7-dioxa-14-azapentacyclo[12.8.0.02,10.04,8.016,21]docosa-1(22),2,4(8),9,16(21),17,19-heptaen-15-one;ethane |
|---|---|
| PubChem CID | 145147642 |
| Molecular Formula | C23H24BrNO5 |
| Molecular Weight | 474.35 g/mol |
| Exact Mass | 473.08 |
| IUPAC Name | 22-bromo-17,18-dimethoxy-5,7-dioxa-14-azapentacyclo[12.8.0.02,10.04,8.016,21]docosa-1(22),2,4(8),9,16(21),17,19-heptaen-15-one;ethane |
| SMILES | CC.COc1ccc2c(Br)c3n(c(=O)c2c1OC)CCCc1cc2c(cc1-3)OCO2 |
| InChI | InChI=1S/C21H18BrNO5.C2H6/c1-25-14-6-5-12-17(20(14)26-2)21(24)23-7-3-4-11-8-15-16(28-10-27-15)9-13(11)19(23)18(12)22;1-2/h5-6,8-9H,3-4,7,10H2,1-2H3;1-2H3 |
| InChIKey | QLHRVNXMUOJREP-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 58.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.35 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |