C26H18F3NO4 — CID 24781296
17-methoxy-21-[(3,4,5-trifluorophenyl)methyl]-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(21),2,4(8),9,14,17,19-heptaen-16-one (PubChem CID 24781296) has the molecular formula C26H18F3NO4 and a molecular weight of 465.43 g/mol. Its IUPAC name is 17-methoxy-21-[(3,4,5-trifluorophenyl)methyl]-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(21),2,4(8),9,14,17,19-heptaen-16-one.
| Compound Name | 17-methoxy-21-[(3,4,5-trifluorophenyl)methyl]-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(21),2,4(8),9,14,17,19-heptaen-16-one |
|---|---|
| PubChem CID | 24781296 |
| Molecular Formula | C26H18F3NO4 |
| Molecular Weight | 465.43 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | 17-methoxy-21-[(3,4,5-trifluorophenyl)methyl]-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(21),2,4(8),9,14,17,19-heptaen-16-one |
| SMILES | COc1ccc2c(Cc3cc(F)c(F)c(F)c3)c3n(cc-2c1=O)CCc1cc2c(cc1-3)OCO2 |
| InChI | InChI=1S/C26H18F3NO4/c1-32-21-3-2-15-17(6-13-7-19(27)24(29)20(28)8-13)25-16-10-23-22(33-12-34-23)9-14(16)4-5-30(25)11-18(15)26(21)31/h2-3,7-11H,4-6,12H2,1H3 |
| InChIKey | FRRRBQSRTDQCKU-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.43 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|