C17H15NO5 — CID 13380419
ethyl 1-formyl-5,6-dihydro-[1,3]benzodioxolo[5,6-g]indolizine-2-carboxylate (PubChem CID 13380419) has the molecular formula C17H15NO5 and a molecular weight of 313.31 g/mol. Its IUPAC name is ethyl 1-formyl-5,6-dihydro-[1,3]benzodioxolo[5,6-g]indolizine-2-carboxylate.
| Compound Name | ethyl 1-formyl-5,6-dihydro-[1,3]benzodioxolo[5,6-g]indolizine-2-carboxylate |
|---|---|
| PubChem CID | 13380419 |
| Molecular Formula | C17H15NO5 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | ethyl 1-formyl-5,6-dihydro-[1,3]benzodioxolo[5,6-g]indolizine-2-carboxylate |
| SMILES | CCOC(=O)c1cn2c(c1C=O)-c1cc3c(cc1CC2)OCO3 |
| InChI | InChI=1S/C17H15NO5/c1-2-21-17(20)12-7-18-4-3-10-5-14-15(23-9-22-14)6-11(10)16(18)13(12)8-19/h5-8H,2-4,9H2,1H3 |
| InChIKey | GWDLWAQHWSQFAQ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 66.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|