C20H20BrNO4 — CID 141294442
ethyl 4-[(5-bromo-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-6-yl)methyl]benzoate (PubChem CID 141294442) has the molecular formula C20H20BrNO4 and a molecular weight of 418.29 g/mol. Its IUPAC name is ethyl 4-[(5-bromo-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-6-yl)methyl]benzoate.
| Compound Name | ethyl 4-[(5-bromo-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-6-yl)methyl]benzoate |
|---|---|
| PubChem CID | 141294442 |
| Molecular Formula | C20H20BrNO4 |
| Molecular Weight | 418.29 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | ethyl 4-[(5-bromo-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-6-yl)methyl]benzoate |
| SMILES | CCOC(=O)c1ccc(CN2CCc3cc4c(cc3C2Br)OCO4)cc1 |
| InChI | InChI=1S/C20H20BrNO4/c1-2-24-20(23)14-5-3-13(4-6-14)11-22-8-7-15-9-17-18(26-12-25-17)10-16(15)19(22)21/h3-6,9-10,19H,2,7-8,11-12H2,1H3 |
| InChIKey | CUUPIIZRUBJHIO-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.29 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|