C24H25NO6 — CID 122203040
diethyl 5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,15,17,19-hexaene-21,21-dicarboxylate (PubChem CID 122203040) has the molecular formula C24H25NO6 and a molecular weight of 423.47 g/mol. Its IUPAC name is diethyl 5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,15,17,19-hexaene-21,21-dicarboxylate.
| Compound Name | diethyl 5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,15,17,19-hexaene-21,21-dicarboxylate |
|---|---|
| PubChem CID | 122203040 |
| Molecular Formula | C24H25NO6 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | diethyl 5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,15,17,19-hexaene-21,21-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)c2ccccc2CN2CCc3cc4c(cc3C21)OCO4 |
| InChI | InChI=1S/C24H25NO6/c1-3-28-22(26)24(23(27)29-4-2)18-8-6-5-7-16(18)13-25-10-9-15-11-19-20(31-14-30-19)12-17(15)21(24)25/h5-8,11-12,21H,3-4,9-10,13-14H2,1-2H3 |
| InChIKey | ROQZIWVMBGUYML-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|