C22H25NO7 — CID 71489192
diethyl (1R,15S,19R)-13-oxo-5,7-dioxa-12-azapentacyclo[10.6.1.02,10.04,8.015,19]nonadeca-2,4(8),9-triene-18,18-dicarboxylate (PubChem CID 71489192) has the molecular formula C22H25NO7 and a molecular weight of 415.44 g/mol. Its IUPAC name is diethyl (1R,15S,19R)-13-oxo-5,7-dioxa-12-azapentacyclo[10.6.1.02,10.04,8.015,19]nonadeca-2,4(8),9-triene-18,18-dicarboxylate.
| Compound Name | diethyl (1R,15S,19R)-13-oxo-5,7-dioxa-12-azapentacyclo[10.6.1.02,10.04,8.015,19]nonadeca-2,4(8),9-triene-18,18-dicarboxylate |
|---|---|
| PubChem CID | 71489192 |
| Molecular Formula | C22H25NO7 |
| Molecular Weight | 415.44 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | diethyl (1R,15S,19R)-13-oxo-5,7-dioxa-12-azapentacyclo[10.6.1.02,10.04,8.015,19]nonadeca-2,4(8),9-triene-18,18-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC[C@H]2CC(=O)N3Cc4cc5c(cc4[C@H]1[C@@H]23)OCO5 |
| InChI | InChI=1S/C22H25NO7/c1-3-27-20(25)22(21(26)28-4-2)6-5-12-8-17(24)23-10-13-7-15-16(30-11-29-15)9-14(13)18(22)19(12)23/h7,9,12,18-19H,3-6,8,10-11H2,1-2H3/t12-,18-,19+/m0/s1 |
| InChIKey | VFRPWJQMCVHXJI-YXKWSERDSA-N |
| XLogP | 2.14 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.44 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|