C27H41NO7Si — CID 102498155
diethyl (1R,2R,11bS)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methyl-2,5,6,11b-tetrahydro-1H-[1,3]benzodioxolo[5,6-g]indolizine-3,3-dicarboxylate (PubChem CID 102498155) has the molecular formula C27H41NO7Si and a molecular weight of 519.71 g/mol. Its IUPAC name is diethyl (1R,2R,11bS)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methyl-2,5,6,11b-tetrahydro-1H-[1,3]benzodioxolo[5,6-g]indolizine-3,3-dicarboxylate.
| Compound Name | diethyl (1R,2R,11bS)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methyl-2,5,6,11b-tetrahydro-1H-[1,3]benzodioxolo[5,6-g]indolizine-3,3-dicarboxylate |
|---|---|
| PubChem CID | 102498155 |
| Molecular Formula | C27H41NO7Si |
| Molecular Weight | 519.71 g/mol |
| Exact Mass | 519.27 |
| IUPAC Name | diethyl (1R,2R,11bS)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methyl-2,5,6,11b-tetrahydro-1H-[1,3]benzodioxolo[5,6-g]indolizine-3,3-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)[C@H](C)[C@@H](CO[Si](C)(C)C(C)(C)C)[C@H]2c3cc4c(cc3CCN21)OCO4 |
| InChI | InChI=1S/C27H41NO7Si/c1-9-31-24(29)27(25(30)32-10-2)17(3)20(15-35-36(7,8)26(4,5)6)23-19-14-22-21(33-16-34-22)13-18(19)11-12-28(23)27/h13-14,17,20,23H,9-12,15-16H2,1-8H3/t17-,20-,23-/m1/s1 |
| InChIKey | ZOTKWROTPGCPLX-HCLVMJGWSA-N |
| XLogP | 4.47 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.71 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|