C24H41NO5Si — CID 46210968
diethyl (3R,4R,5R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methyl-5-[(E)-prop-1-enyl]-1-prop-2-ynylpyrrolidine-2,2-dicarboxylate (PubChem CID 46210968) has the molecular formula C24H41NO5Si and a molecular weight of 451.68 g/mol. Its IUPAC name is diethyl (3R,4R,5R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methyl-5-[(E)-prop-1-enyl]-1-prop-2-ynylpyrrolidine-2,2-dicarboxylate.
| Compound Name | diethyl (3R,4R,5R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methyl-5-[(E)-prop-1-enyl]-1-prop-2-ynylpyrrolidine-2,2-dicarboxylate |
|---|---|
| PubChem CID | 46210968 |
| Molecular Formula | C24H41NO5Si |
| Molecular Weight | 451.68 g/mol |
| Exact Mass | 451.28 |
| IUPAC Name | diethyl (3R,4R,5R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methyl-5-[(E)-prop-1-enyl]-1-prop-2-ynylpyrrolidine-2,2-dicarboxylate |
| SMILES | C#CCN1[C@H](/C=C/C)[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](C)C1(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C24H41NO5Si/c1-11-15-20-19(17-30-31(9,10)23(6,7)8)18(5)24(21(26)28-13-3,22(27)29-14-4)25(20)16-12-2/h2,11,15,18-20H,13-14,16-17H2,1,3-10H3/b15-11+/t18-,19-,20-/m1/s1 |
| InChIKey | DWDIEDFJVVFRHV-UKSDXYAJSA-N |
| XLogP | 4.02 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.68 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|