C27H44O5Si — CID 10863724
diethyl (3E,4R)-3-[(5S)-2-[tert-butyl(dimethyl)silyl]oxy-5-[(E)-prop-1-enyl]cyclopentylidene]-4-ethenylcyclopentane-1,1-dicarboxylate (PubChem CID 10863724) has the molecular formula C27H44O5Si and a molecular weight of 476.73 g/mol. Its IUPAC name is diethyl (3E,4R)-3-[(5S)-2-[tert-butyl(dimethyl)silyl]oxy-5-[(E)-prop-1-enyl]cyclopentylidene]-4-ethenylcyclopentane-1,1-dicarboxylate.
| Compound Name | diethyl (3E,4R)-3-[(5S)-2-[tert-butyl(dimethyl)silyl]oxy-5-[(E)-prop-1-enyl]cyclopentylidene]-4-ethenylcyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 10863724 |
| Molecular Formula | C27H44O5Si |
| Molecular Weight | 476.73 g/mol |
| Exact Mass | 476.30 |
| IUPAC Name | diethyl (3E,4R)-3-[(5S)-2-[tert-butyl(dimethyl)silyl]oxy-5-[(E)-prop-1-enyl]cyclopentylidene]-4-ethenylcyclopentane-1,1-dicarboxylate |
| SMILES | C=C[C@H]1CC(C(=O)OCC)(C(=O)OCC)C/C1=C1\C(O[Si](C)(C)C(C)(C)C)CC[C@H]1/C=C/C |
| InChI | InChI=1S/C27H44O5Si/c1-10-14-20-15-16-22(32-33(8,9)26(5,6)7)23(20)21-18-27(17-19(21)11-2,24(28)30-12-3)25(29)31-13-4/h10-11,14,19-20,22H,2,12-13,15-18H2,1,3-9H3/b14-10+,23-21+/t19-,20+,22?/m0/s1 |
| InChIKey | GGMIUWYEWSNIMM-MJONHORGSA-N |
| XLogP | 6.37 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.73 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|