C25H46O5Si2 — CID 11730567
dimethyl (3Z,4E)-3-(triethylsilylmethylidene)-4-(2-triethylsilyloxypropylidene)cyclopentane-1,1-dicarboxylate (PubChem CID 11730567) has the molecular formula C25H46O5Si2 and a molecular weight of 482.81 g/mol. Its IUPAC name is dimethyl (3Z,4E)-3-(triethylsilylmethylidene)-4-(2-triethylsilyloxypropylidene)cyclopentane-1,1-dicarboxylate.
| Compound Name | dimethyl (3Z,4E)-3-(triethylsilylmethylidene)-4-(2-triethylsilyloxypropylidene)cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 11730567 |
| Molecular Formula | C25H46O5Si2 |
| Molecular Weight | 482.81 g/mol |
| Exact Mass | 482.29 |
| IUPAC Name | dimethyl (3Z,4E)-3-(triethylsilylmethylidene)-4-(2-triethylsilyloxypropylidene)cyclopentane-1,1-dicarboxylate |
| SMILES | CC[Si](/C=C1/CC(C(=O)OC)(C(=O)OC)C/C1=C\C(C)O[Si](CC)(CC)CC)(CC)CC |
| InChI | InChI=1S/C25H46O5Si2/c1-10-31(11-2,12-3)19-22-18-25(23(26)28-8,24(27)29-9)17-21(22)16-20(7)30-32(13-4,14-5)15-6/h16,19-20H,10-15,17-18H2,1-9H3/b21-16+,22-19- |
| InChIKey | VPOAECVWFZUNDQ-FAYYNAPHSA-N |
| XLogP | 6.42 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.81 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|