C29H60O4Si2 — CID 10554180
ethyl (E,3R,7R)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2,2,4-trimethyldodec-4-enoate (PubChem CID 10554180) has the molecular formula C29H60O4Si2 and a molecular weight of 528.97 g/mol. Its IUPAC name is ethyl (E,3R,7R)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2,2,4-trimethyldodec-4-enoate.
| Compound Name | ethyl (E,3R,7R)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2,2,4-trimethyldodec-4-enoate |
|---|---|
| PubChem CID | 10554180 |
| Molecular Formula | C29H60O4Si2 |
| Molecular Weight | 528.97 g/mol |
| Exact Mass | 528.40 |
| IUPAC Name | ethyl (E,3R,7R)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2,2,4-trimethyldodec-4-enoate |
| SMILES | CCCCC[C@H](C/C=C(\C)[C@@H](O[Si](C)(C)C(C)(C)C)C(C)(C)C(=O)OCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H60O4Si2/c1-16-18-19-20-24(32-34(12,13)27(4,5)6)22-21-23(3)25(29(10,11)26(30)31-17-2)33-35(14,15)28(7,8)9/h21,24-25H,16-20,22H2,1-15H3/b23-21+/t24-,25-/m1/s1 |
| InChIKey | GMFPSCZHPMUTSG-NCCZEIKZSA-N |
| XLogP | 9.27 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.97 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|