C18H34O3Si — CID 10925446
ethyl 1,4-dimethyl-7-triethylsilyloxycyclohept-3-ene-1-carboxylate (PubChem CID 10925446) has the molecular formula C18H34O3Si and a molecular weight of 326.55 g/mol. Its IUPAC name is ethyl 1,4-dimethyl-7-triethylsilyloxycyclohept-3-ene-1-carboxylate.
| Compound Name | ethyl 1,4-dimethyl-7-triethylsilyloxycyclohept-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 10925446 |
| Molecular Formula | C18H34O3Si |
| Molecular Weight | 326.55 g/mol |
| Exact Mass | 326.23 |
| IUPAC Name | ethyl 1,4-dimethyl-7-triethylsilyloxycyclohept-3-ene-1-carboxylate |
| SMILES | CCOC(=O)C1(C)CC=C(C)CCC1O[Si](CC)(CC)CC |
| InChI | InChI=1S/C18H34O3Si/c1-7-20-17(19)18(6)14-13-15(5)11-12-16(18)21-22(8-2,9-3)10-4/h13,16H,7-12,14H2,1-6H3 |
| InChIKey | FYVSMGUWAAGUNE-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.55 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|