C18H32O3Si2 — CID 134980335
ethyl (1S,2R)-4-methyl-1-(2-trimethylsilylethynyl)-2-trimethylsilyloxycyclohex-3-ene-1-carboxylate (PubChem CID 134980335) has the molecular formula C18H32O3Si2 and a molecular weight of 352.62 g/mol. Its IUPAC name is ethyl (1S,2R)-4-methyl-1-(2-trimethylsilylethynyl)-2-trimethylsilyloxycyclohex-3-ene-1-carboxylate.
| Compound Name | ethyl (1S,2R)-4-methyl-1-(2-trimethylsilylethynyl)-2-trimethylsilyloxycyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 134980335 |
| Molecular Formula | C18H32O3Si2 |
| Molecular Weight | 352.62 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | ethyl (1S,2R)-4-methyl-1-(2-trimethylsilylethynyl)-2-trimethylsilyloxycyclohex-3-ene-1-carboxylate |
| SMILES | CCOC(=O)[C@]1(C#C[Si](C)(C)C)CCC(C)=C[C@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C18H32O3Si2/c1-9-20-17(19)18(12-13-22(3,4)5)11-10-15(2)14-16(18)21-23(6,7)8/h14,16H,9-11H2,1-8H3/t16-,18+/m1/s1 |
| InChIKey | XRSUSVHLSXUMNQ-AEFFLSMTSA-N |
| XLogP | 4.38 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.62 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|