C18H30O3Si — CID 66559462
(1R,2S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methyl-1-(prop-2-ynoxymethyl)cyclohex-3-ene-1-carbaldehyde (PubChem CID 66559462) has the molecular formula C18H30O3Si and a molecular weight of 322.52 g/mol. Its IUPAC name is (1R,2S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methyl-1-(prop-2-ynoxymethyl)cyclohex-3-ene-1-carbaldehyde.
| Compound Name | (1R,2S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methyl-1-(prop-2-ynoxymethyl)cyclohex-3-ene-1-carbaldehyde |
|---|---|
| PubChem CID | 66559462 |
| Molecular Formula | C18H30O3Si |
| Molecular Weight | 322.52 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | (1R,2S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methyl-1-(prop-2-ynoxymethyl)cyclohex-3-ene-1-carbaldehyde |
| SMILES | C#CCOC[C@]1(C=O)CCC(C)=C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H30O3Si/c1-8-11-20-14-18(13-19)10-9-15(2)12-16(18)21-22(6,7)17(3,4)5/h1,12-13,16H,9-11,14H2,2-7H3/t16-,18+/m0/s1 |
| InChIKey | ROSKBOJLNBYKSS-FUHWJXTLSA-N |
| XLogP | 3.95 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.52 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|