C17H30O3Si2 — CID 102515897
methyl (1S,2S)-4-methyl-1-(2-trimethylsilylethynyl)-2-trimethylsilyloxycyclohex-3-ene-1-carboxylate (PubChem CID 102515897) has the molecular formula C17H30O3Si2 and a molecular weight of 338.60 g/mol. Its IUPAC name is methyl (1S,2S)-4-methyl-1-(2-trimethylsilylethynyl)-2-trimethylsilyloxycyclohex-3-ene-1-carboxylate.
| Compound Name | methyl (1S,2S)-4-methyl-1-(2-trimethylsilylethynyl)-2-trimethylsilyloxycyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 102515897 |
| Molecular Formula | C17H30O3Si2 |
| Molecular Weight | 338.60 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | methyl (1S,2S)-4-methyl-1-(2-trimethylsilylethynyl)-2-trimethylsilyloxycyclohex-3-ene-1-carboxylate |
| SMILES | COC(=O)[C@]1(C#C[Si](C)(C)C)CCC(C)=C[C@@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C17H30O3Si2/c1-14-9-10-17(16(18)19-2,11-12-21(3,4)5)15(13-14)20-22(6,7)8/h13,15H,9-10H2,1-8H3/t15-,17-/m0/s1 |
| InChIKey | QPWPYYVZGLLVKR-RDJZCZTQSA-N |
| XLogP | 3.99 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.60 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|