C27H40O7Si — CID 46872535
dimethyl (5Z)-5-(2-acetyloxyethylidene)-3-[5-[tert-butyl(dimethyl)silyl]oxy-5-methylhex-1-en-3-yn-2-yl]cyclohex-3-ene-1,1-dicarboxylate (PubChem CID 46872535) has the molecular formula C27H40O7Si and a molecular weight of 504.70 g/mol. Its IUPAC name is dimethyl (5Z)-5-(2-acetyloxyethylidene)-3-[5-[tert-butyl(dimethyl)silyl]oxy-5-methylhex-1-en-3-yn-2-yl]cyclohex-3-ene-1,1-dicarboxylate.
| Compound Name | dimethyl (5Z)-5-(2-acetyloxyethylidene)-3-[5-[tert-butyl(dimethyl)silyl]oxy-5-methylhex-1-en-3-yn-2-yl]cyclohex-3-ene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 46872535 |
| Molecular Formula | C27H40O7Si |
| Molecular Weight | 504.70 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | dimethyl (5Z)-5-(2-acetyloxyethylidene)-3-[5-[tert-butyl(dimethyl)silyl]oxy-5-methylhex-1-en-3-yn-2-yl]cyclohex-3-ene-1,1-dicarboxylate |
| SMILES | C=C(C#CC(C)(C)O[Si](C)(C)C(C)(C)C)C1=C/C(=C\COC(C)=O)CC(C(=O)OC)(C(=O)OC)C1 |
| InChI | InChI=1S/C27H40O7Si/c1-19(12-14-26(6,7)34-35(10,11)25(3,4)5)22-16-21(13-15-33-20(2)28)17-27(18-22,23(29)31-8)24(30)32-9/h13,16H,1,15,17-18H2,2-11H3/b21-13+ |
| InChIKey | SLSRJWJGTLHJAO-FYJGNVAPSA-N |
| XLogP | 4.89 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.70 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|