C24H48O4Si — CID 10812480
ethyl (E,3R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-2,2,4-trimethyldodec-4-enoate (PubChem CID 10812480) has the molecular formula C24H48O4Si and a molecular weight of 428.73 g/mol. Its IUPAC name is ethyl (E,3R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-2,2,4-trimethyldodec-4-enoate.
| Compound Name | ethyl (E,3R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-2,2,4-trimethyldodec-4-enoate |
|---|---|
| PubChem CID | 10812480 |
| Molecular Formula | C24H48O4Si |
| Molecular Weight | 428.73 g/mol |
| Exact Mass | 428.33 |
| IUPAC Name | ethyl (E,3R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-2,2,4-trimethyldodec-4-enoate |
| SMILES | CCCCC[C@H](C/C=C(\C)[C@@H](OC)C(C)(C)C(=O)OCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H48O4Si/c1-12-14-15-16-20(28-29(10,11)23(4,5)6)18-17-19(3)21(26-9)24(7,8)22(25)27-13-2/h17,20-21H,12-16,18H2,1-11H3/b19-17+/t20-,21-/m1/s1 |
| InChIKey | KAONRSGFRFJJEP-OADSPKGTSA-N |
| XLogP | 6.90 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.73 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|