C23H46O4Si — CID 11090989
ethyl (E,3R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,2,4-trimethyldodec-4-enoate (PubChem CID 11090989) has the molecular formula C23H46O4Si and a molecular weight of 414.70 g/mol. Its IUPAC name is ethyl (E,3R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,2,4-trimethyldodec-4-enoate.
| Compound Name | ethyl (E,3R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,2,4-trimethyldodec-4-enoate |
|---|---|
| PubChem CID | 11090989 |
| Molecular Formula | C23H46O4Si |
| Molecular Weight | 414.70 g/mol |
| Exact Mass | 414.32 |
| IUPAC Name | ethyl (E,3R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,2,4-trimethyldodec-4-enoate |
| SMILES | CCCCC[C@H](C/C=C(\C)[C@@H](O)C(C)(C)C(=O)OCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H46O4Si/c1-11-13-14-15-19(27-28(9,10)22(4,5)6)17-16-18(3)20(24)23(7,8)21(25)26-12-2/h16,19-20,24H,11-15,17H2,1-10H3/b18-16+/t19-,20-/m1/s1 |
| InChIKey | LMXAPAVZWCTWQO-MJZWWFLCSA-N |
| XLogP | 6.24 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.70 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|