C21H42O3Si — CID 10690561
(E,3R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,2,4-trimethyldodec-4-enal (PubChem CID 10690561) has the molecular formula C21H42O3Si and a molecular weight of 370.65 g/mol. Its IUPAC name is (E,3R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,2,4-trimethyldodec-4-enal.
| Compound Name | (E,3R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,2,4-trimethyldodec-4-enal |
|---|---|
| PubChem CID | 10690561 |
| Molecular Formula | C21H42O3Si |
| Molecular Weight | 370.65 g/mol |
| Exact Mass | 370.29 |
| IUPAC Name | (E,3R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,2,4-trimethyldodec-4-enal |
| SMILES | CCCCC[C@H](C/C=C(\C)[C@@H](O)C(C)(C)C=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H42O3Si/c1-10-11-12-13-18(24-25(8,9)20(3,4)5)15-14-17(2)19(23)21(6,7)16-22/h14,16,18-19,23H,10-13,15H2,1-9H3/b17-14+/t18-,19-/m1/s1 |
| InChIKey | ZRMGTAOIQPDHGE-BOVXVXHCSA-N |
| XLogP | 5.88 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.65 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|